C39H50N5S+ — CID 59482931
N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[1-(3-phenylpropyl)-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine (PubChem CID 59482931) has the molecular formula C39H50N5S+ and a molecular weight of 620.93 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[1-(3-phenylpropyl)-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine.
| Compound Name | N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[1-(3-phenylpropyl)-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 59482931 |
| Molecular Formula | C39H50N5S+ |
| Molecular Weight | 620.93 g/mol |
| Exact Mass | 620.38 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[1-(3-phenylpropyl)-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCN(CCCN(C)C)c1cc(/C=C2\Sc3cccc4c3N2CCC4)c2ccccc2[n+]1CCCc1ccccc1 |
| InChI | InChI=1S/C39H50N5S/c1-40(2)23-13-25-42(26-14-24-41(3)4)37-29-33(30-38-44-28-12-19-32-18-10-22-36(45-38)39(32)44)34-20-8-9-21-35(34)43(37)27-11-17-31-15-6-5-7-16-31/h5-10,15-16,18,20-22,29-30H,11-14,17,19,23-28H2,1-4H3/q+1 |
| InChIKey | UMUXZRVVQCYFMD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 16.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.93 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|