C28H38O5Si — CID 59483017
[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-prop-2-enyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59483017) has the molecular formula C28H38O5Si and a molecular weight of 482.69 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-prop-2-enyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-prop-2-enyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59483017 |
| Molecular Formula | C28H38O5Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-prop-2-enyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=CC[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OC |
| InChI | InChI=1S/C28H38O5Si/c1-8-19-28(24(29-7)23-25(33-28)32-27(5,6)31-23)20-30-34(26(2,3)4,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h8-18,23-25H,1,19-20H2,2-7H3/t23-,24+,25+,28-/m1/s1 |
| InChIKey | IRMFFZXFQSIBER-MEWSVHOLSA-N |
| XLogP | 4.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|