C28H36F2O5Si — CID 59483026
[(3aR,5R,6S,6aR)-5-(3,3-difluoroprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59483026) has the molecular formula C28H36F2O5Si and a molecular weight of 518.67 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(3,3-difluoroprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5R,6S,6aR)-5-(3,3-difluoroprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59483026 |
| Molecular Formula | C28H36F2O5Si |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(3,3-difluoroprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@]1(CC=C(F)F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36F2O5Si/c1-26(2,3)36(20-13-9-7-10-14-20,21-15-11-8-12-16-21)32-19-28(18-17-22(29)30)24(31-6)23-25(35-28)34-27(4,5)33-23/h7-17,23-25H,18-19H2,1-6H3/t23-,24+,25+,28-/m1/s1 |
| InChIKey | IFBSUGKUDJWQHY-MEWSVHOLSA-N |
| XLogP | 5.00 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|