C12H22O3 — CID 59483042
(1R,3S,4R,7S)-1-(hydroxymethyl)-3,5,5,6,6-pentamethyl-2-oxabicyclo[2.2.1]heptan-7-ol (PubChem CID 59483042) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (1R,3S,4R,7S)-1-(hydroxymethyl)-3,5,5,6,6-pentamethyl-2-oxabicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1R,3S,4R,7S)-1-(hydroxymethyl)-3,5,5,6,6-pentamethyl-2-oxabicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 59483042 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (1R,3S,4R,7S)-1-(hydroxymethyl)-3,5,5,6,6-pentamethyl-2-oxabicyclo[2.2.1]heptan-7-ol |
| SMILES | C[C@@H]1O[C@]2(CO)[C@@H](O)[C@H]1C(C)(C)C2(C)C |
| InChI | InChI=1S/C12H22O3/c1-7-8-9(14)12(6-13,15-7)11(4,5)10(8,2)3/h7-9,13-14H,6H2,1-5H3/t7-,8-,9-,12+/m0/s1 |
| InChIKey | KWVGHKPKWMCGHH-PHGLEFOZSA-N |
| XLogP | 1.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |