C17H21NO3 — CID 59483082
N-[[(1S,3R,4R,7S)-1-ethyl-7-hydroxy-5-methylidene-2-oxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide (PubChem CID 59483082) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[[(1S,3R,4R,7S)-1-ethyl-7-hydroxy-5-methylidene-2-oxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide.
| Compound Name | N-[[(1S,3R,4R,7S)-1-ethyl-7-hydroxy-5-methylidene-2-oxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 59483082 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[[(1S,3R,4R,7S)-1-ethyl-7-hydroxy-5-methylidene-2-oxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide |
| SMILES | C=C1C[C@]2(CC)O[C@@H](CNC(=O)c3ccccc3)[C@H]1[C@@H]2O |
| InChI | InChI=1S/C17H21NO3/c1-3-17-9-11(2)14(15(17)19)13(21-17)10-18-16(20)12-7-5-4-6-8-12/h4-8,13-15,19H,2-3,9-10H2,1H3,(H,18,20)/t13-,14-,15-,17-/m0/s1 |
| InChIKey | FZJZYSGEBRXDOM-JKQORVJESA-N |
| XLogP | 1.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|