C29H39FO5Si — CID 59483098
[(3aR,5R,6S,6aR)-5-(1-fluoro-2-methylprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59483098) has the molecular formula C29H39FO5Si and a molecular weight of 514.71 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(1-fluoro-2-methylprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5R,6S,6aR)-5-(1-fluoro-2-methylprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59483098 |
| Molecular Formula | C29H39FO5Si |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(1-fluoro-2-methylprop-2-enyl)-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=C(C)C(F)[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OC |
| InChI | InChI=1S/C29H39FO5Si/c1-20(2)24(30)29(25(31-8)23-26(35-29)34-28(6,7)33-23)19-32-36(27(3,4)5,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-26H,1,19H2,2-8H3/t23-,24?,25+,26+,29+/m1/s1 |
| InChIKey | LDRJNSUVVYFKJP-FBRGYJKSSA-N |
| XLogP | 4.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|