C25H32F2O4Si — CID 59483115
tert-butyl-[[(1R,4R,7S)-6,6-difluoro-3,7-dimethoxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane (PubChem CID 59483115) has the molecular formula C25H32F2O4Si and a molecular weight of 462.61 g/mol. Its IUPAC name is tert-butyl-[[(1R,4R,7S)-6,6-difluoro-3,7-dimethoxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,4R,7S)-6,6-difluoro-3,7-dimethoxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 59483115 |
| Molecular Formula | C25H32F2O4Si |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | tert-butyl-[[(1R,4R,7S)-6,6-difluoro-3,7-dimethoxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane |
| SMILES | COC1O[C@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](OC)[C@H]1CC2(F)F |
| InChI | InChI=1S/C25H32F2O4Si/c1-23(2,3)32(18-12-8-6-9-13-18,19-14-10-7-11-15-19)30-17-24-21(28-4)20(16-25(24,26)27)22(29-5)31-24/h6-15,20-22H,16-17H2,1-5H3/t20-,21+,22?,24-/m1/s1 |
| InChIKey | HNBOPEMKCJNRPG-INXDJGNKSA-N |
| XLogP | 3.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|