C18H36OSi — CID 59483150
tert-butyl-dimethyl-[[(1S,5S)-2,2,3,3,5-pentamethyl-4-methylidenecyclopentyl]methoxy]silane (PubChem CID 59483150) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,5S)-2,2,3,3,5-pentamethyl-4-methylidenecyclopentyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,5S)-2,2,3,3,5-pentamethyl-4-methylidenecyclopentyl]methoxy]silane |
|---|---|
| PubChem CID | 59483150 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,5S)-2,2,3,3,5-pentamethyl-4-methylidenecyclopentyl]methoxy]silane |
| SMILES | C=C1[C@@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H36OSi/c1-13-14(2)17(6,7)18(8,9)15(13)12-19-20(10,11)16(3,4)5/h13,15H,2,12H2,1,3-11H3/t13-,15+/m1/s1 |
| InChIKey | WCIVVJCFEWOQQR-HIFRSBDPSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|