C27H38O6Si — CID 59483188
1-[(3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol (PubChem CID 59483188) has the molecular formula C27H38O6Si and a molecular weight of 486.68 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol.
| Compound Name | 1-[(3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 59483188 |
| Molecular Formula | C27H38O6Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol |
| SMILES | CO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@]1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)O |
| InChI | InChI=1S/C27H38O6Si/c1-19(28)27(23(29-7)22-24(33-27)32-26(5,6)31-22)18-30-34(25(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,19,22-24,28H,18H2,1-7H3/t19?,22-,23+,24+,27+/m1/s1 |
| InChIKey | RFPAHKXPTIUWLF-MDYKFODSSA-N |
| XLogP | 3.21 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|