About 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene
1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene (PubChem CID 59483265) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene.
Molecular Properties
| Compound Name | 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene |
| PubChem CID | 59483265 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene |
| SMILES | CCC12OC(C)C(C(C)=C1C)C2C |
| InChI | InChI=1S/C12H20O/c1-6-12-8(3)7(2)11(9(12)4)10(5)13-12/h9-11H,6H2,1-5H3 |
| InChIKey | XOBWRBWGFGUKAJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene?
The IUPAC name of 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene (CID 59483265) is 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene.
What is the SMILES notation for 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene?
The canonical SMILES for 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene is CCC12OC(C)C(C(C)=C1C)C2C.
What is the InChIKey of 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene?
The InChIKey is XOBWRBWGFGUKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-6-12-8(3)7(2)11(9(12)4)10(5)13-12/h9-11H,6H2,1-5H3.
What are the key properties of 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene?
1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene has a molecular weight of 180.29 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5,6,7-tetramethyl-2-oxabicyclo[2.2.1]hept-5-ene is sourced from PubChem (CID 59483265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).