methyl 1-propylazetidine-3-carboxylate

C8H15NO2 — CID 59484562

IUPACmethyl 1-propylazetidine-3-carboxylate
SMILESCCCN1CC(C(=O)OC)C1
InChIInChI=1S/C8H15NO2/c1-3-4-9-5-7(6-9)8(10)11-2/h7H,3-6H2,1-2H3
InChIKeyRNZOWZZHXOBCLH-UHFFFAOYSA-N
MW157.21 g/mol
LogP0.50
Rot. Bonds3

About methyl 1-propylazetidine-3-carboxylate

methyl 1-propylazetidine-3-carboxylate (PubChem CID 59484562) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is methyl 1-propylazetidine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-propylazetidine-3-carboxylate
PubChem CID59484562
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Namemethyl 1-propylazetidine-3-carboxylate
SMILESCCCN1CC(C(=O)OC)C1
InChIInChI=1S/C8H15NO2/c1-3-4-9-5-7(6-9)8(10)11-2/h7H,3-6H2,1-2H3
InChIKeyRNZOWZZHXOBCLH-UHFFFAOYSA-N
XLogP0.50
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 50.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-propylazetidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-propylazetidine-3-carboxylate?
The IUPAC name of methyl 1-propylazetidine-3-carboxylate (CID 59484562) is methyl 1-propylazetidine-3-carboxylate.
What is the SMILES notation for methyl 1-propylazetidine-3-carboxylate?
The canonical SMILES for methyl 1-propylazetidine-3-carboxylate is CCCN1CC(C(=O)OC)C1.
What is the InChIKey of methyl 1-propylazetidine-3-carboxylate?
The InChIKey is RNZOWZZHXOBCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-3-4-9-5-7(6-9)8(10)11-2/h7H,3-6H2,1-2H3.
What are the key properties of methyl 1-propylazetidine-3-carboxylate?
methyl 1-propylazetidine-3-carboxylate has a molecular weight of 157.21 g/mol, XLogP of 0.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-propylazetidine-3-carboxylate is sourced from PubChem (CID 59484562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).