About 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one
6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one (PubChem CID 59484894) has the molecular formula C23H17F2N3O
and a molecular weight of 389.41 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one |
| PubChem CID | 59484894 |
| Molecular Formula | C23H17F2N3O |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one |
| SMILES | Cc1ccc(-c2cccc(Cn3nc(-c4cc(F)cc(F)c4)ccc3=O)c2)nc1 |
| InChI | InChI=1S/C23H17F2N3O/c1-15-5-6-21(26-13-15)17-4-2-3-16(9-17)14-28-23(29)8-7-22(27-28)18-10-19(24)12-20(25)11-18/h2-13H,14H2,1H3 |
| InChIKey | DOHIURUDQLXXDT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one?
The IUPAC name of 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one (CID 59484894) is 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one.
What is the SMILES notation for 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one?
The canonical SMILES for 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one is Cc1ccc(-c2cccc(Cn3nc(-c4cc(F)cc(F)c4)ccc3=O)c2)nc1.
What is the InChIKey of 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one?
The InChIKey is DOHIURUDQLXXDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2N3O/c1-15-5-6-21(26-13-15)17-4-2-3-16(9-17)14-28-23(29)8-7-22(27-28)18-10-19(24)12-20(25)11-18/h2-13H,14H2,1H3.
What are the key properties of 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one?
6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one has a molecular weight of 389.41 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-difluorophenyl)-2-[[3-(5-methyl-2-pyridinyl)phenyl]methyl]pyridazin-3-one is sourced from PubChem (CID 59484894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).