C24H31NO3 — CID 59485000
2-(4-methoxyphenyl)-4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)morpholine (PubChem CID 59485000) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)morpholine.
| Compound Name | 2-(4-methoxyphenyl)-4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)morpholine |
|---|---|
| PubChem CID | 59485000 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)morpholine |
| SMILES | COc1ccc(C2CN(c3c(C)c(C)c4c(c3C)CC(C)(C)O4)CCO2)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-15-16(2)23-20(13-24(4,5)28-23)17(3)22(15)25-11-12-27-21(14-25)18-7-9-19(26-6)10-8-18/h7-10,21H,11-14H2,1-6H3 |
| InChIKey | MKVVZDPDMCNRAV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|