C25H32N2O2 — CID 59485021
1-[4-[4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)piperazin-1-yl]phenyl]ethanone (PubChem CID 59485021) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-[4-[4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 59485021 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[4-[4-(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(c3c(C)c(C)c4c(c3C)CC(C)(C)O4)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-16-17(2)24-22(15-25(5,6)29-24)18(3)23(16)27-13-11-26(12-14-27)21-9-7-20(8-10-21)19(4)28/h7-10H,11-15H2,1-6H3 |
| InChIKey | VXMVVYWBIBPCBY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|