C16H23NO2 — CID 59485032
4-(2,3,4,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl)morpholine (PubChem CID 59485032) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 4-(2,3,4,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl)morpholine.
| Compound Name | 4-(2,3,4,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl)morpholine |
|---|---|
| PubChem CID | 59485032 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-(2,3,4,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl)morpholine |
| SMILES | Cc1cc(N2CCOCC2)c(C)c2c1OC(C)C2C |
| InChI | InChI=1S/C16H23NO2/c1-10-9-14(17-5-7-18-8-6-17)12(3)15-11(2)13(4)19-16(10)15/h9,11,13H,5-8H2,1-4H3 |
| InChIKey | VGOCTMNMAFRJJN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|