C20H28N2O3S — CID 59485218
2-[N-ethyl-4-(methoxymethoxy)anilino]-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one (PubChem CID 59485218) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-[N-ethyl-4-(methoxymethoxy)anilino]-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one.
| Compound Name | 2-[N-ethyl-4-(methoxymethoxy)anilino]-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 59485218 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[N-ethyl-4-(methoxymethoxy)anilino]-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one |
| SMILES | CCN(C1=NC(=O)C2CCCCCCC2S1)c1ccc(OCOC)cc1 |
| InChI | InChI=1S/C20H28N2O3S/c1-3-22(15-10-12-16(13-11-15)25-14-24-2)20-21-19(23)17-8-6-4-5-7-9-18(17)26-20/h10-13,17-18H,3-9,14H2,1-2H3 |
| InChIKey | IFRIWGJRPIBVOD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|