About 4-tert-butyl-N,1-dimethylpyridin-2-imine
4-tert-butyl-N,1-dimethylpyridin-2-imine (PubChem CID 59485522) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-tert-butyl-N,1-dimethylpyridin-2-imine.
Molecular Properties
| Compound Name | 4-tert-butyl-N,1-dimethylpyridin-2-imine |
| PubChem CID | 59485522 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-tert-butyl-N,1-dimethylpyridin-2-imine |
| SMILES | C/N=c1\cc(C(C)(C)C)ccn1C |
| InChI | InChI=1S/C11H18N2/c1-11(2,3)9-6-7-13(5)10(8-9)12-4/h6-8H,1-5H3/b12-10+ |
| InChIKey | TZCFTXRIWZPPJD-ZRDIBKRKSA-N |
| XLogP | 1.85 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-N,1-dimethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N,1-dimethylpyridin-2-imine?
The IUPAC name of 4-tert-butyl-N,1-dimethylpyridin-2-imine (CID 59485522) is 4-tert-butyl-N,1-dimethylpyridin-2-imine.
What is the SMILES notation for 4-tert-butyl-N,1-dimethylpyridin-2-imine?
The canonical SMILES for 4-tert-butyl-N,1-dimethylpyridin-2-imine is C/N=c1\cc(C(C)(C)C)ccn1C.
What is the InChIKey of 4-tert-butyl-N,1-dimethylpyridin-2-imine?
The InChIKey is TZCFTXRIWZPPJD-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H18N2/c1-11(2,3)9-6-7-13(5)10(8-9)12-4/h6-8H,1-5H3/b12-10+.
What are the key properties of 4-tert-butyl-N,1-dimethylpyridin-2-imine?
4-tert-butyl-N,1-dimethylpyridin-2-imine has a molecular weight of 178.28 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N,1-dimethylpyridin-2-imine is sourced from PubChem (CID 59485522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).