C21H16ClNO3 — CID 59485641
(4S)-3-(4-chlorophenyl)-4-(3-phenoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 59485641) has the molecular formula C21H16ClNO3 and a molecular weight of 365.82 g/mol. Its IUPAC name is (4S)-3-(4-chlorophenyl)-4-(3-phenoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(4-chlorophenyl)-4-(3-phenoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59485641 |
| Molecular Formula | C21H16ClNO3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (4S)-3-(4-chlorophenyl)-4-(3-phenoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2cccc(Oc3ccccc3)c2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClNO3/c22-16-9-11-17(12-10-16)23-20(14-25-21(23)24)15-5-4-8-19(13-15)26-18-6-2-1-3-7-18/h1-13,20H,14H2/t20-/m1/s1 |
| InChIKey | FJGWYQYWVPYMSR-HXUWFJFHSA-N |
| XLogP | 5.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |