C17H16ClN3O3S — CID 59485684
(3S)-2-(4-chlorophenyl)-5-(isocyanomethyl)-3-(3-methoxyphenyl)-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 59485684) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is (3S)-2-(4-chlorophenyl)-5-(isocyanomethyl)-3-(3-methoxyphenyl)-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | (3S)-2-(4-chlorophenyl)-5-(isocyanomethyl)-3-(3-methoxyphenyl)-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 59485684 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (3S)-2-(4-chlorophenyl)-5-(isocyanomethyl)-3-(3-methoxyphenyl)-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | [C-]#[N+]CN1C[C@H](c2cccc(OC)c2)N(c2ccc(Cl)cc2)S1(=O)=O |
| InChI | InChI=1S/C17H16ClN3O3S/c1-19-12-20-11-17(13-4-3-5-16(10-13)24-2)21(25(20,22)23)15-8-6-14(18)7-9-15/h3-10,17H,11-12H2,2H3/t17-/m1/s1 |
| InChIKey | MOORNKQDMSXESM-QGZVFWFLSA-N |
| XLogP | 3.33 |
| TPSA | 54.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|