C20H18N6O2S — CID 59486162
3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-[2-(methylamino)ethylamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 59486162) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-[2-(methylamino)ethylamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-[2-(methylamino)ethylamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59486162 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-[2-(methylamino)ethylamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CNCCNc1nc2sc(C(N)=O)c(N)c2c(-c2cc3ccccc3o2)c1C#N |
| InChI | InChI=1S/C20H18N6O2S/c1-24-6-7-25-19-11(9-21)14(13-8-10-4-2-3-5-12(10)28-13)15-16(22)17(18(23)27)29-20(15)26-19/h2-5,8,24H,6-7,22H2,1H3,(H2,23,27)(H,25,26) |
| InChIKey | SHULBUJKDUDLAR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|