C26H30N4O6 — CID 59486588
4-acetamido-4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide (PubChem CID 59486588) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is 4-acetamido-4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-acetamido-4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486588 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-acetamido-4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2nc(C3(NC(C)=O)CCN(C(=O)N(C)O)CC3)oc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O6/c1-17(31)28-26(13-15-30(16-14-26)25(32)29(2)33)24-27-22(18-5-9-20(34-3)10-6-18)23(36-24)19-7-11-21(35-4)12-8-19/h5-12,33H,13-16H2,1-4H3,(H,28,31) |
| InChIKey | YGNVWTMSWDJKIP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|