About 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole
4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole (PubChem CID 59486937) has the molecular formula C30H32N2O4
and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole |
| PubChem CID | 59486937 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole |
| SMILES | COc1ccc(-c2nc(C3CCNCC3)oc2-c2ccc(OCCOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-33-26-11-7-23(8-12-26)28-29(36-30(32-28)25-15-17-31-18-16-25)24-9-13-27(14-10-24)35-20-19-34-21-22-5-3-2-4-6-22/h2-14,25,31H,15-21H2,1H3 |
| InChIKey | CYBKGGSDQKLDNQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole?
The IUPAC name of 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole (CID 59486937) is 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole?
The canonical SMILES for 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole is COc1ccc(-c2nc(C3CCNCC3)oc2-c2ccc(OCCOCc3ccccc3)cc2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole?
The InChIKey is CYBKGGSDQKLDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O4/c1-33-26-11-7-23(8-12-26)28-29(36-30(32-28)25-15-17-31-18-16-25)24-9-13-27(14-10-24)35-20-19-34-21-22-5-3-2-4-6-22/h2-14,25,31H,15-21H2,1H3.
What are the key properties of 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole?
4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole has a molecular weight of 484.60 g/mol, XLogP of 6.08, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-5-[4-(2-phenylmethoxyethoxy)phenyl]-2-piperidin-4-yl-1,3-oxazole is sourced from PubChem (CID 59486937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).