C26H29F3N2 — CID 59487184
4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]-3-(trifluoromethyl)aniline (PubChem CID 59487184) has the molecular formula C26H29F3N2 and a molecular weight of 426.53 g/mol. Its IUPAC name is 4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 59487184 |
| Molecular Formula | C26H29F3N2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]-3-(trifluoromethyl)aniline |
| SMILES | C[C@H]1CN(C2CCC(c3ccc(N)cc3C(F)(F)F)C2)CCC12C=Cc1ccccc12 |
| InChI | InChI=1S/C26H29F3N2/c1-17-16-31(13-12-25(17)11-10-18-4-2-3-5-23(18)25)21-8-6-19(14-21)22-9-7-20(30)15-24(22)26(27,28)29/h2-5,7,9-11,15,17,19,21H,6,8,12-14,16,30H2,1H3/t17-,19?,21?,25?/m0/s1 |
| InChIKey | HOEJBZXUUMRSOB-UNIYYIQRSA-N |
| XLogP | 6.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|