C17H21NO5S — CID 59487227
ethyl 2-(3-methylsulfonyloxy-1,2,3,4-tetrahydrocarbazol-9-yl)acetate (PubChem CID 59487227) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl 2-(3-methylsulfonyloxy-1,2,3,4-tetrahydrocarbazol-9-yl)acetate.
| Compound Name | ethyl 2-(3-methylsulfonyloxy-1,2,3,4-tetrahydrocarbazol-9-yl)acetate |
|---|---|
| PubChem CID | 59487227 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl 2-(3-methylsulfonyloxy-1,2,3,4-tetrahydrocarbazol-9-yl)acetate |
| SMILES | CCOC(=O)Cn1c2c(c3ccccc31)CC(OS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C17H21NO5S/c1-3-22-17(19)11-18-15-7-5-4-6-13(15)14-10-12(8-9-16(14)18)23-24(2,20)21/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | CJGGHBVVXDWIFB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|