C20H24N4O2 — CID 59487242
propyl 2-[7-(5-methyltriazol-1-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate (PubChem CID 59487242) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is propyl 2-[7-(5-methyltriazol-1-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate.
| Compound Name | propyl 2-[7-(5-methyltriazol-1-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
|---|---|
| PubChem CID | 59487242 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | propyl 2-[7-(5-methyltriazol-1-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
| SMILES | CCCOC(=O)Cc1c2n(c3ccccc13)CC(n1nncc1C)CC2 |
| InChI | InChI=1S/C20H24N4O2/c1-3-10-26-20(25)11-17-16-6-4-5-7-18(16)23-13-15(8-9-19(17)23)24-14(2)12-21-22-24/h4-7,12,15H,3,8-11,13H2,1-2H3 |
| InChIKey | ZGBRLLZORCEJFQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|