About methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate
methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate (PubChem CID 59487840) has the molecular formula C22H22F2O4S2
and a molecular weight of 452.54 g/mol. Its IUPAC name is methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate.
Molecular Properties
| Compound Name | methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate |
| PubChem CID | 59487840 |
| Molecular Formula | C22H22F2O4S2 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)CCCC[C@H]1CCSS1 |
| InChI | InChI=1S/C22H22F2O4S2/c1-27-22(26)18-12-14(17-8-7-15(23)13-19(17)24)6-9-20(18)28-21(25)5-3-2-4-16-10-11-29-30-16/h6-9,12-13,16H,2-5,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | YKXVMNPTMQFKTJ-INIZCTEOSA-N |
| XLogP | 6.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate?
The IUPAC name of methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate (CID 59487840) is methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate.
What is the SMILES notation for methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate?
The canonical SMILES for methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate is COC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)CCCC[C@H]1CCSS1.
What is the InChIKey of methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate?
The InChIKey is YKXVMNPTMQFKTJ-INIZCTEOSA-N. The full InChI is InChI=1S/C22H22F2O4S2/c1-27-22(26)18-12-14(17-8-7-15(23)13-19(17)24)6-9-20(18)28-21(25)5-3-2-4-16-10-11-29-30-16/h6-9,12-13,16H,2-5,10-11H2,1H3/t16-/m0/s1.
What are the key properties of methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate?
methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate has a molecular weight of 452.54 g/mol, XLogP of 6.04, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,4-difluorophenyl)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]benzoate is sourced from PubChem (CID 59487840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).