C46H58O5S2 — CID 59487899
[2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]carbonylphenyl] 2-methylbenzoate (PubChem CID 59487899) has the molecular formula C46H58O5S2 and a molecular weight of 755.10 g/mol. Its IUPAC name is [2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]carbonylphenyl] 2-methylbenzoate.
| Compound Name | [2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]carbonylphenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 59487899 |
| Molecular Formula | C46H58O5S2 |
| Molecular Weight | 755.10 g/mol |
| Exact Mass | 754.37 |
| IUPAC Name | [2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]carbonylphenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccccc1C(=O)Oc1c(C(C)(C)C)cc(SC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C46H58O5S2/c1-28-20-16-17-21-31(28)40(48)50-37-23-19-18-22-32(37)41(49)51-39-35(44(8,9)10)26-30(27-36(39)45(11,12)13)53-46(14,15)52-29-24-33(42(2,3)4)38(47)34(25-29)43(5,6)7/h16-27,47H,1-15H3 |
| InChIKey | DLKPFWTYDCYMBP-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.10 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|