C9H7Cl5 — CID 59488975
1,5-dichloro-2-methyl-4-(2,2,2-trichloroethyl)benzene (PubChem CID 59488975) has the molecular formula C9H7Cl5 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,5-dichloro-2-methyl-4-(2,2,2-trichloroethyl)benzene.
| Compound Name | 1,5-dichloro-2-methyl-4-(2,2,2-trichloroethyl)benzene |
|---|---|
| PubChem CID | 59488975 |
| Molecular Formula | C9H7Cl5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 289.90 |
| IUPAC Name | 1,5-dichloro-2-methyl-4-(2,2,2-trichloroethyl)benzene |
| SMILES | Cc1cc(CC(Cl)(Cl)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl5/c1-5-2-6(4-9(12,13)14)8(11)3-7(5)10/h2-3H,4H2,1H3 |
| InChIKey | RBFUQFXWNLXWTF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|