C14H10O2S3 — CID 59489445
5,7-dithiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 59489445) has the molecular formula C14H10O2S3 and a molecular weight of 306.43 g/mol. Its IUPAC name is 5,7-dithiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-dithiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 59489445 |
| Molecular Formula | C14H10O2S3 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5,7-dithiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1csc(-c2sc(-c3cccs3)c3c2OCCO3)c1 |
| InChI | InChI=1S/C14H10O2S3/c1-3-9(17-7-1)13-11-12(16-6-5-15-11)14(19-13)10-4-2-8-18-10/h1-4,7-8H,5-6H2 |
| InChIKey | PGEFOYCABFETGN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |