About 3-methoxy-4,7-dimethyl-1H-isoindole
3-methoxy-4,7-dimethyl-1H-isoindole (PubChem CID 594896) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-methoxy-4,7-dimethyl-1H-isoindole.
Molecular Properties
| Compound Name | 3-methoxy-4,7-dimethyl-1H-isoindole |
| PubChem CID | 594896 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-methoxy-4,7-dimethyl-1H-isoindole |
| SMILES | COC1=NCc2c(C)ccc(C)c21 |
| InChI | InChI=1S/C11H13NO/c1-7-4-5-8(2)10-9(7)6-12-11(10)13-3/h4-5H,6H2,1-3H3 |
| InChIKey | MKYMOXIDYCAAPX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-4,7-dimethyl-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4,7-dimethyl-1H-isoindole?
The IUPAC name of 3-methoxy-4,7-dimethyl-1H-isoindole (CID 594896) is 3-methoxy-4,7-dimethyl-1H-isoindole.
What is the SMILES notation for 3-methoxy-4,7-dimethyl-1H-isoindole?
The canonical SMILES for 3-methoxy-4,7-dimethyl-1H-isoindole is COC1=NCc2c(C)ccc(C)c21.
What is the InChIKey of 3-methoxy-4,7-dimethyl-1H-isoindole?
The InChIKey is MKYMOXIDYCAAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-7-4-5-8(2)10-9(7)6-12-11(10)13-3/h4-5H,6H2,1-3H3.
What are the key properties of 3-methoxy-4,7-dimethyl-1H-isoindole?
3-methoxy-4,7-dimethyl-1H-isoindole has a molecular weight of 175.23 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4,7-dimethyl-1H-isoindole is sourced from PubChem (CID 594896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).