About N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine
N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine (PubChem CID 59489601) has the molecular formula C23H22ClFN4
and a molecular weight of 408.91 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine.
Molecular Properties
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine |
| PubChem CID | 59489601 |
| Molecular Formula | C23H22ClFN4 |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine |
| SMILES | Fc1ccc(CNc2ncc3c(n2)-c2ccccc2C2(CCNCC2)C3)cc1Cl |
| InChI | InChI=1S/C23H22ClFN4/c24-19-11-15(5-6-20(19)25)13-27-22-28-14-16-12-23(7-9-26-10-8-23)18-4-2-1-3-17(18)21(16)29-22/h1-6,11,14,26H,7-10,12-13H2,(H,27,28,29) |
| InChIKey | QTYAJKVGDXQYID-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine?
The IUPAC name of N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine (CID 59489601) is N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine.
What is the SMILES notation for N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine?
The canonical SMILES for N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine is Fc1ccc(CNc2ncc3c(n2)-c2ccccc2C2(CCNCC2)C3)cc1Cl.
What is the InChIKey of N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine?
The InChIKey is QTYAJKVGDXQYID-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClFN4/c24-19-11-15(5-6-20(19)25)13-27-22-28-14-16-12-23(7-9-26-10-8-23)18-4-2-1-3-17(18)21(16)29-22/h1-6,11,14,26H,7-10,12-13H2,(H,27,28,29).
What are the key properties of N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine?
N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine has a molecular weight of 408.91 g/mol, XLogP of 4.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-fluorophenyl)methyl]spiro[5H-benzo[h]quinazoline-6,4'-piperidine]-2-amine is sourced from PubChem (CID 59489601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).