C31H36N6S — CID 59489816
N-[3-(4-methylpiperazin-1-yl)propyl]-6-[4-(thiophen-3-ylmethylamino)phenyl]-5,6-dihydrobenzo[h]quinazolin-2-amine (PubChem CID 59489816) has the molecular formula C31H36N6S and a molecular weight of 524.74 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-6-[4-(thiophen-3-ylmethylamino)phenyl]-5,6-dihydrobenzo[h]quinazolin-2-amine.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-6-[4-(thiophen-3-ylmethylamino)phenyl]-5,6-dihydrobenzo[h]quinazolin-2-amine |
|---|---|
| PubChem CID | 59489816 |
| Molecular Formula | C31H36N6S |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-6-[4-(thiophen-3-ylmethylamino)phenyl]-5,6-dihydrobenzo[h]quinazolin-2-amine |
| SMILES | CN1CCN(CCCNc2ncc3c(n2)-c2ccccc2C(c2ccc(NCc4ccsc4)cc2)C3)CC1 |
| InChI | InChI=1S/C31H36N6S/c1-36-14-16-37(17-15-36)13-4-12-32-31-34-21-25-19-29(27-5-2-3-6-28(27)30(25)35-31)24-7-9-26(10-8-24)33-20-23-11-18-38-22-23/h2-3,5-11,18,21-22,29,33H,4,12-17,19-20H2,1H3,(H,32,34,35) |
| InChIKey | YXEZLAXULACALJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|