C25H29ClN4 — CID 59489858
N-[6-(4-chlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]-N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 59489858) has the molecular formula C25H29ClN4 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]-N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N-[6-(4-chlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]-N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 59489858 |
| Molecular Formula | C25H29ClN4 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[6-(4-chlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]-N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNc1ncc2c(n1)-c1ccccc1C(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C25H29ClN4/c1-25(2,16-30(3)4)15-28-24-27-14-18-13-22(17-9-11-19(26)12-10-17)20-7-5-6-8-21(20)23(18)29-24/h5-12,14,22H,13,15-16H2,1-4H3,(H,27,28,29) |
| InChIKey | BPRUCBGSGYZPQI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |