C33H36FN7O — CID 59490002
1-(3-fluorophenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea (PubChem CID 59490002) has the molecular formula C33H36FN7O and a molecular weight of 565.70 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 59490002 |
| Molecular Formula | C33H36FN7O |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea |
| SMILES | CN1CCN(CCCNc2ncc3c(n2)-c2ccccc2C(c2ccc(NC(=O)Nc4cccc(F)c4)cc2)C3)CC1 |
| InChI | InChI=1S/C33H36FN7O/c1-40-16-18-41(19-17-40)15-5-14-35-32-36-22-24-20-30(28-8-2-3-9-29(28)31(24)39-32)23-10-12-26(13-11-23)37-33(42)38-27-7-4-6-25(34)21-27/h2-4,6-13,21-22,30H,5,14-20H2,1H3,(H,35,36,39)(H2,37,38,42) |
| InChIKey | PDVINPQYFYZJJL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|