C40H43N7O2 — CID 59490092
1-(2-methoxy-5-phenylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea (PubChem CID 59490092) has the molecular formula C40H43N7O2 and a molecular weight of 653.83 g/mol. Its IUPAC name is 1-(2-methoxy-5-phenylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea.
| Compound Name | 1-(2-methoxy-5-phenylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 59490092 |
| Molecular Formula | C40H43N7O2 |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.35 |
| IUPAC Name | 1-(2-methoxy-5-phenylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea |
| SMILES | COc1ccc(-c2ccccc2)cc1NC(=O)Nc1ccc(C2Cc3cnc(NCCCN4CCN(C)CC4)nc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C40H43N7O2/c1-46-21-23-47(24-22-46)20-8-19-41-39-42-27-31-25-35(33-11-6-7-12-34(33)38(31)45-39)29-13-16-32(17-14-29)43-40(48)44-36-26-30(15-18-37(36)49-2)28-9-4-3-5-10-28/h3-7,9-18,26-27,35H,8,19-25H2,1-2H3,(H,41,42,45)(H2,43,44,48) |
| InChIKey | VIHCUWPQSPQWLQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|