C34H38N6O2 — CID 59490172
4-methoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide (PubChem CID 59490172) has the molecular formula C34H38N6O2 and a molecular weight of 562.72 g/mol. Its IUPAC name is 4-methoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59490172 |
| Molecular Formula | C34H38N6O2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 4-methoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C3Cc4cnc(NCCCN5CCN(C)CC5)nc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C34H38N6O2/c1-39-18-20-40(21-19-39)17-5-16-35-34-36-23-26-22-31(29-6-3-4-7-30(29)32(26)38-34)24-8-12-27(13-9-24)37-33(41)25-10-14-28(42-2)15-11-25/h3-4,6-15,23,31H,5,16-22H2,1-2H3,(H,37,41)(H,35,36,38) |
| InChIKey | IVWXCGZECQKZTO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|