C35H39N7O3 — CID 59490184
methyl 2-[[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]carbamoylamino]benzoate (PubChem CID 59490184) has the molecular formula C35H39N7O3 and a molecular weight of 605.74 g/mol. Its IUPAC name is methyl 2-[[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]carbamoylamino]benzoate.
| Compound Name | methyl 2-[[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 59490184 |
| Molecular Formula | C35H39N7O3 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | methyl 2-[[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Nc1ccc(C2Cc3cnc(NCCCN4CCN(C)CC4)nc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C35H39N7O3/c1-41-18-20-42(21-19-41)17-7-16-36-34-37-23-25-22-30(27-8-3-4-9-28(27)32(25)40-34)24-12-14-26(15-13-24)38-35(44)39-31-11-6-5-10-29(31)33(43)45-2/h3-6,8-15,23,30H,7,16-22H2,1-2H3,(H,36,37,40)(H2,38,39,44) |
| InChIKey | ZGOHGYMHODSVJW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|