C32H34FN5O2 — CID 59490344
N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-3-fluoro-4-methoxybenzamide (PubChem CID 59490344) has the molecular formula C32H34FN5O2 and a molecular weight of 539.66 g/mol. Its IUPAC name is N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-3-fluoro-4-methoxybenzamide.
| Compound Name | N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 59490344 |
| Molecular Formula | C32H34FN5O2 |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C3Cc4cnc(NCCCCN(C)C)nc4-c4ccccc43)cc2)cc1F |
| InChI | InChI=1S/C32H34FN5O2/c1-38(2)17-7-6-16-34-32-35-20-23-18-27(25-8-4-5-9-26(25)30(23)37-32)21-10-13-24(14-11-21)36-31(39)22-12-15-29(40-3)28(33)19-22/h4-5,8-15,19-20,27H,6-7,16-18H2,1-3H3,(H,36,39)(H,34,35,37) |
| InChIKey | ZWFFZQCPJOYVSS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|