C14H11N3O — CID 59490807
8-oxa-13,15,16-triazatetracyclo[9.7.0.02,7.014,18]octadeca-1(18),2,4,6,11,13,16-heptaene (PubChem CID 59490807) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-oxa-13,15,16-triazatetracyclo[9.7.0.02,7.014,18]octadeca-1(18),2,4,6,11,13,16-heptaene.
| Compound Name | 8-oxa-13,15,16-triazatetracyclo[9.7.0.02,7.014,18]octadeca-1(18),2,4,6,11,13,16-heptaene |
|---|---|
| PubChem CID | 59490807 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 8-oxa-13,15,16-triazatetracyclo[9.7.0.02,7.014,18]octadeca-1(18),2,4,6,11,13,16-heptaene |
| SMILES | c1ccc2c(c1)OCCc1cnc3[nH]ncc3c1-2 |
| InChI | InChI=1S/C14H11N3O/c1-2-4-12-10(3-1)13-9(5-6-18-12)7-15-14-11(13)8-16-17-14/h1-4,7-8H,5-6H2,(H,15,16,17) |
| InChIKey | HYXIKBLYONHYAY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |