C23H28O5 — CID 59491281
[(2S,3R,5S)-2,6-dimethyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 59491281) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is [(2S,3R,5S)-2,6-dimethyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,5S)-2,6-dimethyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 59491281 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [(2S,3R,5S)-2,6-dimethyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(OCc2ccccc2)[C@@H](OCc2ccccc2)C(C)O[C@H]1C |
| InChI | InChI=1S/C23H28O5/c1-16-21(25-14-19-10-6-4-7-11-19)23(22(17(2)27-16)28-18(3)24)26-15-20-12-8-5-9-13-20/h4-13,16-17,21-23H,14-15H2,1-3H3/t16?,17-,21-,22+,23?/m0/s1 |
| InChIKey | DXFLRNJMOOSZQL-VAOMWAPRSA-N |
| XLogP | 3.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |