C11H9N3 — CID 59491924
7,8-dihydropyrido[2,3-b][1,8]naphthyridine (PubChem CID 59491924) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 7,8-dihydropyrido[2,3-b][1,8]naphthyridine.
| Compound Name | 7,8-dihydropyrido[2,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 59491924 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 7,8-dihydropyrido[2,3-b][1,8]naphthyridine |
| SMILES | C1=c2cc3cccnc3nc2=NCC1 |
| InChI | InChI=1S/C11H9N3/c1-3-8-7-9-4-2-6-13-11(9)14-10(8)12-5-1/h1,3-5,7H,2,6H2 |
| InChIKey | MWYPNXPBMCGVDC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |