C19H32O3 — CID 59492071
(3R,5S)-1-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptane-3,5-diol (PubChem CID 59492071) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (3R,5S)-1-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptane-3,5-diol.
| Compound Name | (3R,5S)-1-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptane-3,5-diol |
|---|---|
| PubChem CID | 59492071 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (3R,5S)-1-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptane-3,5-diol |
| SMILES | CC[C@H](O)C[C@H](O)CC[C@@H]1[C@@H]2C(=C[C@H](C)C[C@@H]2O)C=C[C@@H]1C |
| InChI | InChI=1S/C19H32O3/c1-4-15(20)11-16(21)7-8-17-13(3)5-6-14-9-12(2)10-18(22)19(14)17/h5-6,9,12-13,15-22H,4,7-8,10-11H2,1-3H3/t12-,13-,15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | QKMHUDUGJSAHAF-MPONPYIASA-N |
| XLogP | 3.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |