About 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione
7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione (PubChem CID 59492146) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione |
| PubChem CID | 59492146 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione |
| SMILES | CC(=O)c1ccc2c(=O)oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C11H9NO4/c1-6(13)7-3-4-8-9(5-7)12(2)11(15)16-10(8)14/h3-5H,1-2H3 |
| InChIKey | YTVOVJRHHIVCPG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione?
The IUPAC name of 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione (CID 59492146) is 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione.
What is the SMILES notation for 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione?
The canonical SMILES for 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione is CC(=O)c1ccc2c(=O)oc(=O)n(C)c2c1.
What is the InChIKey of 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione?
The InChIKey is YTVOVJRHHIVCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c1-6(13)7-3-4-8-9(5-7)12(2)11(15)16-10(8)14/h3-5H,1-2H3.
What are the key properties of 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione?
7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione has a molecular weight of 219.20 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-acetyl-1-methyl-3,1-benzoxazine-2,4-dione is sourced from PubChem (CID 59492146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).