C24H39O4P — CID 59492203
[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dihydrogen phosphate (PubChem CID 59492203) has the molecular formula C24H39O4P and a molecular weight of 422.55 g/mol. Its IUPAC name is [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dihydrogen phosphate.
| Compound Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59492203 |
| Molecular Formula | C24H39O4P |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dihydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(CC)COP(=O)(O)O |
| InChI | InChI=1S/C24H39O4P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(4-2)23-28-29(25,26)27/h5-6,8-9,11-12,14-15,17-18,20-21,24H,3-4,7,10,13,16,19,22-23H2,1-2H3,(H2,25,26,27)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | BEBRJTQTCTWHCJ-YNUSHXQLSA-N |
| XLogP | 7.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|