C25H40O3S — CID 59492206
[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] methanesulfonate (PubChem CID 59492206) has the molecular formula C25H40O3S and a molecular weight of 420.66 g/mol. Its IUPAC name is [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] methanesulfonate.
| Compound Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] methanesulfonate |
|---|---|
| PubChem CID | 59492206 |
| Molecular Formula | C25H40O3S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] methanesulfonate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(CC)COS(C)(=O)=O |
| InChI | InChI=1S/C25H40O3S/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(5-2)24-28-29(3,26)27/h6-7,9-10,12-13,15-16,18-19,21-22,25H,4-5,8,11,14,17,20,23-24H2,1-3H3/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21- |
| InChIKey | JPISVOLWLQNUBQ-WSDBEMKQSA-N |
| XLogP | 7.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|