C23H36OS — CID 59492217
(4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol (PubChem CID 59492217) has the molecular formula C23H36OS and a molecular weight of 360.61 g/mol. Its IUPAC name is (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol.
| Compound Name | (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol |
|---|---|
| PubChem CID | 59492217 |
| Molecular Formula | C23H36OS |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C/CC(CO)SC |
| InChI | InChI=1S/C23H36OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(22-24)25-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-24H,3,6,9,12,15,18,21-22H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19+ |
| InChIKey | HBTLAKGBHBTSDH-UFDDNHIKSA-N |
| XLogP | 6.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|