C24H38OS — CID 59492252
(4E,7Z,10Z,13Z,16Z,19Z)-2-ethylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol (PubChem CID 59492252) has the molecular formula C24H38OS and a molecular weight of 374.63 g/mol. Its IUPAC name is (4E,7Z,10Z,13Z,16Z,19Z)-2-ethylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol.
| Compound Name | (4E,7Z,10Z,13Z,16Z,19Z)-2-ethylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol |
|---|---|
| PubChem CID | 59492252 |
| Molecular Formula | C24H38OS |
| Molecular Weight | 374.63 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (4E,7Z,10Z,13Z,16Z,19Z)-2-ethylsulfanyldocosa-4,7,10,13,16,19-hexaen-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C/CC(CO)SCC |
| InChI | InChI=1S/C24H38OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(23-25)26-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,24-25H,3-4,7,10,13,16,19,22-23H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20+ |
| InChIKey | LOXDFYXJZWLSPY-KUSSBYQRSA-N |
| XLogP | 7.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|