C21H38OS — CID 59492254
(11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trien-1-ol (PubChem CID 59492254) has the molecular formula C21H38OS and a molecular weight of 338.60 g/mol. Its IUPAC name is (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trien-1-ol.
| Compound Name | (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trien-1-ol |
|---|---|
| PubChem CID | 59492254 |
| Molecular Formula | C21H38OS |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trien-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCC(CO)SC |
| InChI | InChI=1S/C21H38OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(20-22)23-2/h4-5,7-8,10-11,21-22H,3,6,9,12-20H2,1-2H3/b5-4-,8-7-,11-10- |
| InChIKey | KBLWIDJLKNKFQY-YSTUJMKBSA-N |
| XLogP | 6.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|