C20H36OS — CID 59492268
(9Z,12Z,15Z)-2-ethylsulfanyloctadeca-9,12,15-trien-1-ol (PubChem CID 59492268) has the molecular formula C20H36OS and a molecular weight of 324.57 g/mol. Its IUPAC name is (9Z,12Z,15Z)-2-ethylsulfanyloctadeca-9,12,15-trien-1-ol.
| Compound Name | (9Z,12Z,15Z)-2-ethylsulfanyloctadeca-9,12,15-trien-1-ol |
|---|---|
| PubChem CID | 59492268 |
| Molecular Formula | C20H36OS |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (9Z,12Z,15Z)-2-ethylsulfanyloctadeca-9,12,15-trien-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(CO)SCC |
| InChI | InChI=1S/C20H36OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(19-21)22-4-2/h5-6,8-9,11-12,20-21H,3-4,7,10,13-19H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | SXIRUNDRJZFNTD-AGRJPVHOSA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|