C20H14F3NO — CID 59492518
2-(2-methyl-4-pyridinyl)-9-(trifluoromethyl)fluoren-9-ol (PubChem CID 59492518) has the molecular formula C20H14F3NO and a molecular weight of 341.33 g/mol. Its IUPAC name is 2-(2-methyl-4-pyridinyl)-9-(trifluoromethyl)fluoren-9-ol.
| Compound Name | 2-(2-methyl-4-pyridinyl)-9-(trifluoromethyl)fluoren-9-ol |
|---|---|
| PubChem CID | 59492518 |
| Molecular Formula | C20H14F3NO |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-(2-methyl-4-pyridinyl)-9-(trifluoromethyl)fluoren-9-ol |
| SMILES | Cc1cc(-c2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)ccn1 |
| InChI | InChI=1S/C20H14F3NO/c1-12-10-14(8-9-24-12)13-6-7-16-15-4-2-3-5-17(15)19(25,18(16)11-13)20(21,22)23/h2-11,25H,1H3 |
| InChIKey | VLCDCADMDOXNQW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |